EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5NO3 |
| Net Charge | 0 |
| Average Mass | 139.110 |
| Monoisotopic Mass | 139.02694 |
| SMILES | O=C(O)c1ccc(O)nc1 |
| InChI | InChI=1S/C6H5NO3/c8-5-2-1-4(3-7-5)6(9)10/h1-3H,(H,7,8)(H,9,10) |
| InChIKey | BLHCMGRVFXRYRN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| urine (BTO:0001419) | PubMed (21389975) | ||
| - | MetaboLights (MTBLS20) | From MetaboLights | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | PubMed (10952545) |
| Roles Classification |
|---|
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxynicotinic acid (CHEBI:16168) has functional parent nicotinic acid (CHEBI:15940) |
| 6-hydroxynicotinic acid (CHEBI:16168) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| 6-hydroxynicotinic acid (CHEBI:16168) has role human urinary metabolite (CHEBI:84087) |
| 6-hydroxynicotinic acid (CHEBI:16168) has role mouse metabolite (CHEBI:75771) |
| 6-hydroxynicotinic acid (CHEBI:16168) is a monohydroxypyridine (CHEBI:38182) |
| 6-hydroxynicotinic acid (CHEBI:16168) is conjugate acid of 6-hydroxynicotinate(1−) (CHEBI:57664) |
| Incoming Relation(s) |
| 6-hydroxynicotinate(1−) (CHEBI:57664) is conjugate base of 6-hydroxynicotinic acid (CHEBI:16168) |
| IUPAC Name |
|---|
| 6-hydroxypyridine-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| 6-Hydroxynicotinate | KEGG COMPOUND |
| 6-Hydroxynicotinic acid | KEGG COMPOUND |
| Citations |
|---|