EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H30N6O12 |
| Net Charge | 0 |
| Average Mass | 810.732 |
| Monoisotopic Mass | 810.19217 |
| SMILES | O=C(O[C@H]1[C@H](OC(=O)c2cccnc2)[C@@H](OC(=O)c2cccnc2)[C@H](OC(=O)c2cccnc2)[C@@H](OC(=O)c2cccnc2)[C@H]1OC(=O)c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C42H30N6O12/c49-37(25-7-1-13-43-19-25)55-31-32(56-38(50)26-8-2-14-44-20-26)34(58-40(52)28-10-4-16-46-22-28)36(60-42(54)30-12-6-18-48-24-30)35(59-41(53)29-11-5-17-47-23-29)33(31)57-39(51)27-9-3-15-45-21-27/h1-24,31-36H/t31-,32-,33-,34+,35-,36- |
| InChIKey | MFZCIDXOLLEMOO-GYSGTQPESA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myo-inositol hexanicotinate (CHEBI:31699) has functional parent myo-inositol (CHEBI:17268) |
| myo-inositol hexanicotinate (CHEBI:31699) has functional parent nicotinic acid (CHEBI:15940) |
| myo-inositol hexanicotinate (CHEBI:31699) has role cardiovascular drug (CHEBI:35554) |
| myo-inositol hexanicotinate (CHEBI:31699) is a inositol hexanicotinate (CHEBI:33064) |
| IUPAC Name |
|---|
| (1r,2R,3S,4s,5R,6S)-cyclohexane-1,2,3,4,5,6-hexayl hexanicotinate |
| INNs | Source |
|---|---|
| nicotinate d'inositol | WHO MedNet |
| nicotinato de inositol | WHO MedNet |
| Synonyms | Source |
|---|---|
| Dilcit | ChEMBL |
| Dilexpal | ChEMBL |
| Esantene | ChEMBL |
| Hamovannid | ChEMBL |
| Inositol hexanicotinate | KEGG COMPOUND |
| inositol niacinate | ChEMBL |
| Brand Names | Source |
|---|---|
| Hexopal | ChEMBL |
| Linodil | ChEMBL |
| Palohex | ChEMBL |
| Citations |
|---|