EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H12Cl2N2O |
| Net Charge | 0 |
| Average Mass | 343.213 |
| Monoisotopic Mass | 342.03267 |
| SMILES | O=C(Nc1ccccc1-c1ccc(Cl)cc1)c1cccnc1Cl |
| InChI | InChI=1S/C18H12Cl2N2O/c19-13-9-7-12(8-10-13)14-4-1-2-6-16(14)22-18(23)15-5-3-11-21-17(15)20/h1-11H,(H,22,23) |
| InChIKey | WYEMLYFITZORAB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. EC 1.3.5.1 [succinate dehydrogenase (quinone)] inhibitor An EC 1.3.5.* (oxidoreductase acting on CH-CH of donor with a quinone or related compound as acceptor) inhibitor that interferes with the action of succinate dehydrogenase (quinone), EC 1.3.5.1. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| boscalid (CHEBI:81822) has functional parent nicotinic acid (CHEBI:15940) |
| boscalid (CHEBI:81822) has role antifungal agrochemical (CHEBI:86328) |
| boscalid (CHEBI:81822) has role EC 1.3.5.1 [succinate dehydrogenase (quinone)] inhibitor (CHEBI:83072) |
| boscalid (CHEBI:81822) has role environmental contaminant (CHEBI:78298) |
| boscalid (CHEBI:81822) has role xenobiotic (CHEBI:35703) |
| boscalid (CHEBI:81822) is a anilide fungicide (CHEBI:87015) |
| boscalid (CHEBI:81822) is a biphenyls (CHEBI:22888) |
| boscalid (CHEBI:81822) is a monochlorobenzenes (CHEBI:83403) |
| boscalid (CHEBI:81822) is a pyridinecarboxamide (CHEBI:25529) |
| Incoming Relation(s) |
| Boscalid Glc ac a and b (CHEBI:143795) has functional parent boscalid (CHEBI:81822) |
| Mercapturic conjugation of Boscalid (CHEBI:143796) has functional parent boscalid (CHEBI:81822) |
| IUPAC Name |
|---|
| 2-chloro-N-(4'-chlorobiphenyl-2-yl)nicotinamide |
| Synonyms | Source |
|---|---|
| 2-chloro-N-(4'-chloro[1,1'-biphenyl]-2-yl)-3-pyridinecarboxamide | Alan Wood's Pesticides |
| 2-chloro-N-(4'-chloro[1,1'-biphenyl]-2-yl)pyridine-3-carboxamide | Alan Wood's Pesticides |
| Bas 510 | ChEMBL |
| Bas-510 | ChEMBL |
| BAS 510 F | ChEMBL |
| Boscalid | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10092464 | Reaxys |
| CAS:188425-85-6 | KEGG COMPOUND |
| CAS:188425-85-6 | ChemIDplus |
| Citations |
|---|