EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H39NO11 |
| Net Charge | 0 |
| Average Mass | 613.660 |
| Monoisotopic Mass | 613.25231 |
| SMILES | [H][C@@]12[C@@H](OC(=O)c3cccnc3)[C@@]34CO[C@](O)([C@@](C)(O)[C@]3([H])[C@@H](C(=C)C)C=C[C@H]4OC(C)=O)[C@@]1(OC(C)=O)C[C@H](C)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C32H39NO11/c1-16(2)22-10-11-23(41-18(4)34)30-15-40-32(39,29(7,38)26(22)30)31(44-20(6)36)13-17(3)25(42-19(5)35)24(31)27(30)43-28(37)21-9-8-12-33-14-21/h8-12,14,17,22-27,38-39H,1,13,15H2,2-7H3/t17-,22+,23+,24+,25-,26-,27+,29-,30+,31+,32+/m0/s1 |
| InChIKey | JWNQQMAJTFWUKZ-PJWNUARVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia decipiens (ncbitaxon:1031519) | whole plant (BTO:0001461) | PubMed (12808253) | Air-dried ground plants |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.5.1.5 (urease) inhibitor EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the activity of urease (EC 3.5.1.5), reducing hydrolysis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Euphorbia diterpenoid 2 (CHEBI:65884) has functional parent nicotinic acid (CHEBI:15940) |
| Euphorbia diterpenoid 2 (CHEBI:65884) has role EC 3.5.1.5 (urease) inhibitor (CHEBI:50635) |
| Euphorbia diterpenoid 2 (CHEBI:65884) has role metabolite (CHEBI:25212) |
| Euphorbia diterpenoid 2 (CHEBI:65884) is a acetate ester (CHEBI:47622) |
| Euphorbia diterpenoid 2 (CHEBI:65884) is a bridged compound (CHEBI:35990) |
| Euphorbia diterpenoid 2 (CHEBI:65884) is a cyclic ether (CHEBI:37407) |
| Euphorbia diterpenoid 2 (CHEBI:65884) is a lactol (CHEBI:38131) |
| Euphorbia diterpenoid 2 (CHEBI:65884) is a tetracyclic diterpenoid (CHEBI:52557) |
| IUPAC Name |
|---|
| (2S,3S,3aR,4R,4aR,5R,8S,8aR,9S,10R,10aR)-3,5,10a-tris(acetyloxy)-9,10-dihydroxy-2,9-dimethyl-8-(prop-1-en-2-yl)-2,3,3a,4,5,8,8a,9,10,10a-decahydro-1H-10,4a-(epoxymethano)benzo[f]azulen-4-yl pyridine-3-carboxylate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9460756 | Reaxys |
| Citations |
|---|