EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11N |
| Net Charge | 0 |
| Average Mass | 169.227 |
| Monoisotopic Mass | 169.08915 |
| SMILES | c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10,13H |
| InChIKey | DMBHHRLKUKUOEG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. EC 1.3.99.29 [phytoene desaturase (zeta-carotene-forming)] inhibitor An EC 1.3.99.* (oxidoreductase acting on donor CH-CH group with other acceptors) inhibitor that interferes with the action of phytoene desaturase (ζ-carotene-forming), EC 1.3.99.29, an enzyme of carotenoid biosynthesis that converts phytoene into ζ-carotene (zeta-carotene) via the symmetrical introduction of two double bonds at the C-11 and C-11' positions of phytoene. carotogenesis inhibitor Any inhibitor of the biosynthesis of carotenoids. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphenylamine (CHEBI:4640) has role antifungal agrochemical (CHEBI:86328) |
| diphenylamine (CHEBI:4640) has role antioxidant (CHEBI:22586) |
| diphenylamine (CHEBI:4640) has role carotogenesis inhibitor (CHEBI:72773) |
| diphenylamine (CHEBI:4640) has role EC 1.3.99.29 [phytoene desaturase (ζ-carotene-forming)] inhibitor (CHEBI:72774) |
| diphenylamine (CHEBI:4640) has role ferroptosis inhibitor (CHEBI:173084) |
| diphenylamine (CHEBI:4640) has role radical scavenger (CHEBI:48578) |
| diphenylamine (CHEBI:4640) is a aromatic amine (CHEBI:33860) |
| diphenylamine (CHEBI:4640) is a bridged diphenyl fungicide (CHEBI:87039) |
| diphenylamine (CHEBI:4640) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| p-aminodiphenylamine (CHEBI:59038) has functional parent diphenylamine (CHEBI:4640) |
| 5-[2-(2-oxoethoxy)ethoxy]-diclofenac (CHEBI:61752) has functional parent diphenylamine (CHEBI:4640) |
| amocarzine (CHEBI:38946) has functional parent diphenylamine (CHEBI:4640) |
| amoscanate (CHEBI:38944) has functional parent diphenylamine (CHEBI:4640) |
| diclofenac (CHEBI:47381) has functional parent diphenylamine (CHEBI:4640) |
| flufenamate (CHEBI:520819) has functional parent diphenylamine (CHEBI:4640) |
| flufenamic acid (CHEBI:42638) has functional parent diphenylamine (CHEBI:4640) |
| IUPAC Name |
|---|
| N-phenylaniline |
| Synonyms | Source |
|---|---|
| anilinobenzene | NIST Chemistry WebBook |
| C6H5‒NH‒C6H5 | IUPAC |
| Diphenylamine | KEGG COMPOUND |
| DPA | NIST Chemistry WebBook |
| N,N-diphenylamine | ChemIDplus |
| N-phenylbenzenamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1335 | PPDB |
| C11016 | KEGG COMPOUND |
| CPD-9937 | MetaCyc |
| diphenylamine | Alan Wood's Pesticides |
| Diphenylamine | Wikipedia |
| HMDB0032562 | HMDB |
| Citations |
|---|