EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21N5O2S |
| Net Charge | 0 |
| Average Mass | 371.466 |
| Monoisotopic Mass | 371.14160 |
| SMILES | CN1CCN(C(=S)Nc2ccc(Nc3ccc([N+](=O)[O-])cc3)cc2)CC1 |
| InChI | InChI=1S/C18H21N5O2S/c1-21-10-12-22(13-11-21)18(26)20-16-4-2-14(3-5-16)19-15-6-8-17(9-7-15)23(24)25/h2-9,19H,10-13H2,1H3,(H,20,26) |
| InChIKey | UFLRJROFPAGRPN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antinematodal drug A substance used in the treatment or control of nematode infestations. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amocarzine (CHEBI:38946) has functional parent diphenylamine (CHEBI:4640) |
| amocarzine (CHEBI:38946) has role antinematodal drug (CHEBI:35444) |
| amocarzine (CHEBI:38946) is a C-nitro compound (CHEBI:35716) |
| amocarzine (CHEBI:38946) is a N-methylpiperazine (CHEBI:46920) |
| amocarzine (CHEBI:38946) is a secondary amino compound (CHEBI:50995) |
| amocarzine (CHEBI:38946) is a thioureas (CHEBI:51276) |
| IUPAC Name |
|---|
| 4-methyl-N-{4-[(4-nitrophenyl)amino]phenyl}piperazine-1-carbothioamide |
| INNs | Source |
|---|---|
| amocarzine | ChemIDplus |
| amocarzina | ChemIDplus |
| amocarzinum | ChemIDplus |
| amocarzine | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-methyl-N-(4-((4-nitrophenyl)amino)phenyl)-1-piperazinecarbothioamide | ChemIDplus |
| phenthiourezine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 185 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:850745 | Beilstein |
| CAS:36590-19-9 | ChemIDplus |
| Citations |
|---|