EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10F3NO2 |
| Net Charge | 0 |
| Average Mass | 281.233 |
| Monoisotopic Mass | 281.06636 |
| SMILES | O=C(O)c1ccccc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10F3NO2/c15-14(16,17)9-4-3-5-10(8-9)18-12-7-2-1-6-11(12)13(19)20/h1-8,18H,(H,19,20) |
| InChIKey | LPEPZBJOKDYZAD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flufenamic acid (CHEBI:42638) has functional parent (trifluoromethyl)benzene (CHEBI:36810) |
| flufenamic acid (CHEBI:42638) has functional parent anthranilic acid (CHEBI:30754) |
| flufenamic acid (CHEBI:42638) has functional parent diphenylamine (CHEBI:4640) |
| flufenamic acid (CHEBI:42638) has role antipyretic (CHEBI:35493) |
| flufenamic acid (CHEBI:42638) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| flufenamic acid (CHEBI:42638) has role non-narcotic analgesic (CHEBI:35481) |
| flufenamic acid (CHEBI:42638) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| flufenamic acid (CHEBI:42638) is a aromatic amino acid (CHEBI:33856) |
| flufenamic acid (CHEBI:42638) is a organofluorine compound (CHEBI:37143) |
| flufenamic acid (CHEBI:42638) is conjugate acid of flufenamate (CHEBI:520819) |
| Incoming Relation(s) |
| flufenamate (CHEBI:520819) is conjugate base of flufenamic acid (CHEBI:42638) |
| IUPAC Name |
|---|
| 2-{[3-(trifluoromethyl)phenyl]amino}benzoic acid |
| INNs | Source |
|---|---|
| acide flufénamique | ChemIDplus |
| ácido flufenámico | ChemIDplus |
| acidum flufenamicum | ChemIDplus |
| flufenamic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-[3-(trifluoromethyl)anilino]benzoic acid | NIST Chemistry WebBook |
| 2-[[3-(TRIFLUOROMETHYL)PHENYL]AMINO] BENZOIC ACID | PDBeChem |
| 3'-trifluoromethyldiphenylamine-2-carboxylic acid | ChemIDplus |
| N-(3-trifluoromethylphenyl)anthranilic acid | ChemIDplus |
| N-(α,α,α-trifluoro-m-tolyl)anthranilic acid | NIST Chemistry WebBook |
| FFA | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Achless | ChemIDplus |
| Citations |
|---|