EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H9N3O2S |
| Net Charge | 0 |
| Average Mass | 271.301 |
| Monoisotopic Mass | 271.04155 |
| SMILES | O=[N+]([O-])c1ccc(Nc2ccc(N=C=S)cc2)cc1 |
| InChI | InChI=1S/C13H9N3O2S/c17-16(18)13-7-5-12(6-8-13)15-11-3-1-10(2-4-11)14-9-19/h1-8,15H |
| InChIKey | DKVNAGXPRSYHLB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | schistosomicide drug Drugs that used to treat infestations by flukes (trematodes) of the genus Schistosoma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amoscanate (CHEBI:38944) has functional parent diphenylamine (CHEBI:4640) |
| amoscanate (CHEBI:38944) has role schistosomicide drug (CHEBI:38941) |
| amoscanate (CHEBI:38944) is a C-nitro compound (CHEBI:35716) |
| amoscanate (CHEBI:38944) is a isothiocyanate (CHEBI:52221) |
| amoscanate (CHEBI:38944) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 4-isothiocyanato-N-(4-nitrophenyl)aniline |
| INNs | Source |
|---|---|
| amoscanate | ChemIDplus |
| amoscanato | ChemIDplus |
| amoscanatum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-isothiocyanato-4'-nitrodiphenylamine | ChemIDplus |
| 4-isothiocyanato-N-(4-nitrophenyl)benzenamine | ChemIDplus |
| p-(p-nitroanilino)phenyl isothiocyanate | ChemIDplus |
| isothiocyanic acid, p-(p-nitroanilino)phenyl ester | ChemIDplus |
| nithiocyamine | ChemIDplus |
| 4-(4-Nitroanilino)phenylisothiocyanat | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 189 | DrugCentral |
| Amoscanate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:888705 | Beilstein |
| CAS:26328-53-0 | ChemIDplus |
| Citations |
|---|