EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17Cl2NO5 |
| Net Charge | 0 |
| Average Mass | 398.242 |
| Monoisotopic Mass | 397.04838 |
| SMILES | [H]C(=O)COCCOc1ccc(Nc2c(Cl)cccc2Cl)c(CC(=O)O)c1 |
| InChI | InChI=1S/C18H17Cl2NO5/c19-14-2-1-3-15(20)18(14)21-16-5-4-13(10-12(16)11-17(23)24)26-9-8-25-7-6-22/h1-6,10,21H,7-9,11H2,(H,23,24) |
| InChIKey | DEQMKNZAJVYQCL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-[2-(2-oxoethoxy)ethoxy]-diclofenac (CHEBI:61752) has functional parent diphenylamine (CHEBI:4640) |
| 5-[2-(2-oxoethoxy)ethoxy]-diclofenac (CHEBI:61752) has functional parent phenylacetic acid (CHEBI:30745) |
| 5-[2-(2-oxoethoxy)ethoxy]-diclofenac (CHEBI:61752) has role allergen (CHEBI:50904) |
| 5-[2-(2-oxoethoxy)ethoxy]-diclofenac (CHEBI:61752) is a dichlorobenzene (CHEBI:23697) |
| 5-[2-(2-oxoethoxy)ethoxy]-diclofenac (CHEBI:61752) is a phenylacetic acids (CHEBI:25978) |
| IUPAC Name |
|---|
| {2-[(2,6-dichlorophenyl)amino]-5-[2-(2-oxoethoxy)ethoxy]phenyl}acetic acid |
| Synonym | Source |
|---|---|
| DF5der | ChEBI |
| Citations |
|---|