EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12N2 |
| Net Charge | 0 |
| Average Mass | 184.242 |
| Monoisotopic Mass | 184.10005 |
| SMILES | Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C12H12N2/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9,14H,13H2 |
| InChIKey | ATGUVEKSASEFFO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-aminodiphenylamine (CHEBI:59038) has functional parent diphenylamine (CHEBI:4640) |
| p-aminodiphenylamine (CHEBI:59038) has role allergen (CHEBI:50904) |
| p-aminodiphenylamine (CHEBI:59038) is a aromatic amine (CHEBI:33860) |
| p-aminodiphenylamine (CHEBI:59038) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| N,N'-diphenyl-1,4-phenylenediamine (CHEBI:34860) has functional parent p-aminodiphenylamine (CHEBI:59038) |
| IUPAC Name |
|---|
| N-phenylbenzene-1,4-diamine |
| Synonyms | Source |
|---|---|
| 4-Aminodiphenylamine | ChemIDplus |
| Azosalt R | ChemIDplus |
| Luxan Black R | ChemIDplus |
| N-(4-Aminophenyl)aniline | ChemIDplus |
| N, 4'-Bianiline | ChemIDplus |
| N-4'-Bianiline | ChemIDplus |
| Citations |
|---|