EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:30794 - malonic acid
| Formula | C3H4O4 |
| Net Charge | 0 |
| Average Mass | 104.061 |
| Monoisotopic Mass | 104.01096 |
| SMILES | O=C(O)CC(=O)O |
| InChI | InChI=1S/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7) |
| InChIKey | OFOBLEOULBTSOW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| malonic acid (CHEBI:30794) has role human metabolite (CHEBI:77746) |
| malonic acid (CHEBI:30794) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| malonic acid (CHEBI:30794) is conjugate acid of malonate(1−) (CHEBI:30795) |
| Incoming Relation(s) |
| N-malonyltryptophan (CHEBI:142268) has functional parent malonic acid (CHEBI:30794) |
| O-malonyl-D-carnitine (CHEBI:86047) has functional parent malonic acid (CHEBI:30794) |
| O-malonyl-L-carnitine (CHEBI:85470) has functional parent malonic acid (CHEBI:30794) |
| O-malonylcarnitine (CHEBI:73028) has functional parent malonic acid (CHEBI:30794) |
| S-malonyl-4'-phosphopantetheine (CHEBI:132976) has functional parent malonic acid (CHEBI:30794) |
| 3-(benzyloxy)-3-oxopropanoic acid (CHEBI:84093) has functional parent malonic acid (CHEBI:30794) |
| 3-oxo-3-ureidopropanoic acid (CHEBI:49049) has functional parent malonic acid (CHEBI:30794) |
| aminomalonic acid (CHEBI:17475) has functional parent malonic acid (CHEBI:30794) |
| bumadizone (CHEBI:76119) has functional parent malonic acid (CHEBI:30794) |
| elesclomol (CHEBI:79369) has functional parent malonic acid (CHEBI:30794) |
| ethylmalonic acid (CHEBI:741548) has functional parent malonic acid (CHEBI:30794) |
| heptylmalonic acid (CHEBI:70747) has functional parent malonic acid (CHEBI:30794) |
| hydroxymalonic acid (CHEBI:16513) has functional parent malonic acid (CHEBI:30794) |
| isoprothiolane (CHEBI:6047) has functional parent malonic acid (CHEBI:30794) |
| malonamide (CHEBI:48537) has functional parent malonic acid (CHEBI:30794) |
| malonate ester (CHEBI:38083) has functional parent malonic acid (CHEBI:30794) |
| malonyl-CoA methyl ester (CHEBI:71244) has functional parent malonic acid (CHEBI:30794) |
| methylmalonic acid (CHEBI:30860) has functional parent malonic acid (CHEBI:30794) |
| oxomalonic acid (CHEBI:30842) has functional parent malonic acid (CHEBI:30794) |
| malonate(1−) (CHEBI:30795) is conjugate base of malonic acid (CHEBI:30794) |
| carboxyacetyl group (CHEBI:50650) is substituent group from malonic acid (CHEBI:30794) |
| malonyl group (CHEBI:25134) is substituent group from malonic acid (CHEBI:30794) |
| IUPAC Name |
|---|
| propanedioic acid |
| Synonyms | Source |
|---|---|
| HOOC‒CH2‒COOH | IUPAC |
| H2malo | IUPAC |
| Malonic acid | KEGG COMPOUND |
| MALONIC ACID | PDBeChem |
| Propanedioic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00001193 | KNApSAcK |
| C00383 | KEGG COMPOUND |
| DB02175 | DrugBank |
| HMDB0000691 | HMDB |
| LMFA01170041 | LIPID MAPS |
| MALONATE | MetaCyc |
| Malonic_acid | Wikipedia |
| MLA | PDBeChem |
| Citations |
|---|