EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N2O3 |
| Net Charge | 0 |
| Average Mass | 326.396 |
| Monoisotopic Mass | 326.16304 |
| SMILES | CCCCC(C(=O)O)C(=O)N(Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O3/c1-2-3-14-17(19(23)24)18(22)21(16-12-8-5-9-13-16)20-15-10-6-4-7-11-15/h4-13,17,20H,2-3,14H2,1H3,(H,23,24) |
| InChIKey | FLWFHHFTIRLFPV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bumadizone (CHEBI:76119) has functional parent malonic acid (CHEBI:30794) |
| bumadizone (CHEBI:76119) has role antipyretic (CHEBI:35493) |
| bumadizone (CHEBI:76119) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| bumadizone (CHEBI:76119) is a carbohydrazide (CHEBI:35363) |
| bumadizone (CHEBI:76119) is a monocarboxylic acid (CHEBI:25384) |
| bumadizone (CHEBI:76119) is conjugate acid of bumadizone(1−) (CHEBI:76124) |
| Incoming Relation(s) |
| bumadizone(1−) (CHEBI:76124) is conjugate base of bumadizone (CHEBI:76119) |
| IUPAC Name |
|---|
| 2-[(1,2-diphenylhydrazino)carbonyl]hexanoic acid |
| INNs | Source |
|---|---|
| bumadizone | KEGG DRUG |
| bumadizona | ChemIDplus |
| bumadizonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Butylmalonic acid mono(1,2-diphenylhydrazide) | ChemIDplus |
| n-Butylmalonic acid N,N'-diphenylhydrazide | ChemIDplus |
| bumazidone | ChEBI |
| Bumadizon | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D07264 | KEGG DRUG |
| US2005249806 | Patent |
| WO2006124753 | Patent |
| Bumadizone | Wikipedia |
| 426 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:696638 | Reaxys |
| CAS:3583-64-0 | KEGG DRUG |
| CAS:3583-64-0 | ChemIDplus |
| Citations |
|---|