EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O4 |
| Net Charge | 0 |
| Average Mass | 132.115 |
| Monoisotopic Mass | 132.04226 |
| SMILES | CCC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C5H8O4/c1-2-3(4(6)7)5(8)9/h3H,2H2,1H3,(H,6,7)(H,8,9) |
| InChIKey | UKFXDFUAPNAMPJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethylmalonic acid (CHEBI:741548) has functional parent malonic acid (CHEBI:30794) |
| ethylmalonic acid (CHEBI:741548) has role human metabolite (CHEBI:77746) |
| ethylmalonic acid (CHEBI:741548) is a dicarboxylic acid (CHEBI:35692) |
| ethylmalonic acid (CHEBI:741548) is a dicarboxylic fatty acid (CHEBI:189840) |
| ethylmalonic acid (CHEBI:741548) is conjugate acid of ethylmalonate (CHEBI:132938) |
| ethylmalonic acid (CHEBI:741548) is conjugate acid of ethylmalonate(2−) (CHEBI:132939) |
| Incoming Relation(s) |
| (R)-ethylmalonyl-CoA (CHEBI:85803) has functional parent ethylmalonic acid (CHEBI:741548) |
| (S)-ethylmalonyl-CoA (CHEBI:60907) has functional parent ethylmalonic acid (CHEBI:741548) |
| ethylmalonate (CHEBI:132938) is conjugate base of ethylmalonic acid (CHEBI:741548) |
| ethylmalonate(2−) (CHEBI:132939) is conjugate base of ethylmalonic acid (CHEBI:741548) |
| IUPAC Name |
|---|
| ethylpropanedioic acid |
| Synonyms | Source |
|---|---|
| 1,1-propanedicarboxylic acid | ChemIDplus |
| 2-ethylmalonic acid | NIST Chemistry WebBook |
| α-carboxybutyric acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000622 | HMDB |
| Citations |
|---|