EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40N7O19P3S |
| Net Charge | 0 |
| Average Mass | 867.614 |
| Monoisotopic Mass | 867.13125 |
| SMILES | COC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C25H40N7O19P3S/c1-25(2,20(37)23(38)28-5-4-14(33)27-6-7-55-16(35)8-15(34)46-3)10-48-54(44,45)51-53(42,43)47-9-13-19(50-52(39,40)41)18(36)24(49-13)32-12-31-17-21(26)29-11-30-22(17)32/h11-13,18-20,24,36-37H,4-10H2,1-3H3,(H,27,33)(H,28,38)(H,42,43)(H,44,45)(H2,26,29,30)(H2,39,40,41)/t13-,18-,19-,20?,24-/m1/s1 |
| InChIKey | CHQAJZULNPRMEN-FZEDXVDRSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| malonyl-CoA methyl ester (CHEBI:71244) has functional parent malonic acid (CHEBI:30794) |
| malonyl-CoA methyl ester (CHEBI:71244) is a acyl-CoA (CHEBI:17984) |
| malonyl-CoA methyl ester (CHEBI:71244) is a methyl ester (CHEBI:25248) |
| malonyl-CoA methyl ester (CHEBI:71244) is conjugate acid of malonyl-CoA methyl ester(4−) (CHEBI:71242) |
| Incoming Relation(s) |
| malonyl-CoA methyl ester(4−) (CHEBI:71242) is conjugate base of malonyl-CoA methyl ester (CHEBI:71244) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-{[3-({2-[(3-methoxy-3-oxopropanoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| 5'-O-[hydroxy({hydroxy[(15-hydroxy-16,16-dimethyl-3,5,10,14-tetraoxo-2-oxa-6-thia-9,13-diazaheptadecan-17-yl)oxy]phosphoryl}oxy)phosphoryl]adenosine 3'-(dihydrogen phosphate) | IUPAC |
| malonyl-coenzyme A methyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-12454 | MetaCyc |