EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20N4O2S2 |
| Net Charge | 0 |
| Average Mass | 400.529 |
| Monoisotopic Mass | 400.10277 |
| SMILES | CN(NC(=O)CC(=O)NN(C)C(=S)c1ccccc1)C(=S)c1ccccc1 |
| InChI | InChI=1S/C19H20N4O2S2/c1-22(18(26)14-9-5-3-6-10-14)20-16(24)13-17(25)21-23(2)19(27)15-11-7-4-8-12-15/h3-12H,13H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | BKJIXTWSNXCKJH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elesclomol (CHEBI:79369) has functional parent malonic acid (CHEBI:30794) |
| elesclomol (CHEBI:79369) has role antineoplastic agent (CHEBI:35610) |
| elesclomol (CHEBI:79369) has role apoptosis inducer (CHEBI:68495) |
| elesclomol (CHEBI:79369) is a carbohydrazide (CHEBI:35363) |
| elesclomol (CHEBI:79369) is a thiocarbonyl compound (CHEBI:50492) |
| Incoming Relation(s) |
| elesclomol-Cu(II) (CHEBI:79377) has part elesclomol (CHEBI:79369) |
| IUPAC Name |
|---|
| N'1,N'3-dimethyl-N'1,N'3-bis(phenylcarbonothioyl)malonohydrazide |
| INNs | Source |
|---|---|
| elesclomol | ChemIDplus |
| elesclomol | WHO MedNet |
| élesclomol | WHO MedNet |
| elesclomolum | WHO MedNet |
| Synonym | Source |
|---|---|
| 1-N'-Benzenecarbothioyl-3-(2-benzenecarbothioyl-2-methylhydrazinyl)-N'-methyl-oxopropanehydrazidide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D08909 | KEGG DRUG |
| Elesclomol | Wikipedia |
| LSM-4929 | LINCS |
| WO2011133673 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11332608 | Reaxys |
| CAS:488832-69-5 | KEGG DRUG |
| CAS:488832-69-5 | ChemIDplus |
| Citations |
|---|