EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O4 |
| Net Charge | 0 |
| Average Mass | 202.250 |
| Monoisotopic Mass | 202.12051 |
| SMILES | CCCCCCCC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H18O4/c1-2-3-4-5-6-7-8(9(11)12)10(13)14/h8H,2-7H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | YSFZWUJOBANROZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heptylmalonic acid (CHEBI:70747) has functional parent malonic acid (CHEBI:30794) |
| heptylmalonic acid (CHEBI:70747) has role metabolite (CHEBI:25212) |
| heptylmalonic acid (CHEBI:70747) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| heptylpropanedioic acid |
| Synonyms | Source |
|---|---|
| 2-heptylmalonic acid | ChEBI |
| 2-heptylpropanedioic acid | ChEBI |
| n-Heptylmalonic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1777731 | Reaxys |
| CAS:760-54-3 | ChemIDplus |
| Citations |
|---|