EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18O4S2 |
| Net Charge | 0 |
| Average Mass | 290.406 |
| Monoisotopic Mass | 290.06465 |
| SMILES | CC(C)OC(=O)C(C(=O)OC(C)C)=C1SCCS1 |
| InChI | InChI=1S/C12H18O4S2/c1-7(2)15-10(13)9(11(14)16-8(3)4)12-17-5-6-18-12/h7-8H,5-6H2,1-4H3 |
| InChIKey | UFHLMYOGRXOCSL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. phospholipid biosynthesis inhibitor Any compound that inhibits the biosynthesis of any phospholipid. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoprothiolane (CHEBI:6047) has functional parent malonic acid (CHEBI:30794) |
| isoprothiolane (CHEBI:6047) has parent hydride 1,3-dithiolane (CHEBI:38079) |
| isoprothiolane (CHEBI:6047) has role antifungal agrochemical (CHEBI:86328) |
| isoprothiolane (CHEBI:6047) has role environmental contaminant (CHEBI:78298) |
| isoprothiolane (CHEBI:6047) has role insecticide (CHEBI:24852) |
| isoprothiolane (CHEBI:6047) has role phospholipid biosynthesis inhibitor (CHEBI:83741) |
| isoprothiolane (CHEBI:6047) is a dithiolanes (CHEBI:39192) |
| isoprothiolane (CHEBI:6047) is a isopropyl ester (CHEBI:35725) |
| isoprothiolane (CHEBI:6047) is a malonate ester (CHEBI:38083) |
| Incoming Relation(s) |
| isoprothiolane sulfoxide (CHEBI:6048) has functional parent isoprothiolane (CHEBI:6047) |
| IUPAC Name |
|---|
| di(propan-2-yl) 1,3-dithiolan-2-ylidenemalonate |
| Synonyms | Source |
|---|---|
| bis(1-methylethyl) 1,3-dithiolan-2-ylidenepropanedioate | ChemIDplus |
| diisopropyl 1,3-dithiolan-2-ylidenemalonate | IUPAC |
| di-isopropyl 1,3-dithiolane-2-ylidenemalonate | NIST Chemistry WebBook |
| diisopropyl 2-(1,3-dithiolan-2-ylidene)malonate | NIST Chemistry WebBook |
| Isoprothiolane | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 408 | PPDB |
| C11111 | KEGG COMPOUND |
| HMDB0031779 | HMDB |
| isoprothiolane | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2128528 | Reaxys |
| CAS:50512-35-1 | ChemIDplus |
| CAS:50512-35-1 | NIST Chemistry WebBook |
| CAS:50512-35-1 | KEGG COMPOUND |
| Citations |
|---|