EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18O4S2 |
| Net Charge | 0 |
| Average Mass | 290.406 |
| Monoisotopic Mass | 290.06465 |
| SMILES | CC(C)OC(=O)C(C(=O)OC(C)C)=C1SCCS1 |
| InChI | InChI=1S/C12H18O4S2/c1-7(2)15-10(13)9(11(14)16-8(3)4)12-17-5-6-18-12/h7-8H,5-6H2,1-4H3 |
| InChIKey | UFHLMYOGRXOCSL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | phospholipid biosynthesis inhibitor Any compound that inhibits the biosynthesis of any phospholipid. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoprothiolane (CHEBI:6047) has functional parent malonic acid (CHEBI:30794) |
| isoprothiolane (CHEBI:6047) has parent hydride 1,3-dithiolane (CHEBI:38079) |
| isoprothiolane (CHEBI:6047) has role antifungal agrochemical (CHEBI:86328) |
| isoprothiolane (CHEBI:6047) has role environmental contaminant (CHEBI:78298) |
| isoprothiolane (CHEBI:6047) has role insecticide (CHEBI:24852) |
| isoprothiolane (CHEBI:6047) has role phospholipid biosynthesis inhibitor (CHEBI:83741) |
| isoprothiolane (CHEBI:6047) is a dithiolanes (CHEBI:39192) |
| isoprothiolane (CHEBI:6047) is a isopropyl ester (CHEBI:35725) |
| isoprothiolane (CHEBI:6047) is a malonate ester (CHEBI:38083) |
| Incoming Relation(s) |
| isoprothiolane sulfoxide (CHEBI:6048) has functional parent isoprothiolane (CHEBI:6047) |
| IUPAC Name |
|---|
| di(propan-2-yl) 1,3-dithiolan-2-ylidenemalonate |
| Synonyms | Source |
|---|---|
| bis(1-methylethyl) 1,3-dithiolan-2-ylidenepropanedioate | ChemIDplus |
| diisopropyl 1,3-dithiolan-2-ylidenemalonate | IUPAC |
| di-isopropyl 1,3-dithiolane-2-ylidenemalonate | NIST Chemistry WebBook |
| diisopropyl 2-(1,3-dithiolan-2-ylidene)malonate | NIST Chemistry WebBook |
| Isoprothiolane | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 408 | PPDB |
| C11111 | KEGG COMPOUND |
| HMDB0031779 | HMDB |
| isoprothiolane | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2128528 | Reaxys |
| CAS:50512-35-1 | ChemIDplus |
| CAS:50512-35-1 | NIST Chemistry WebBook |
| CAS:50512-35-1 | KEGG COMPOUND |
| Citations |
|---|