EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O4 |
| Net Charge | 0 |
| Average Mass | 194.186 |
| Monoisotopic Mass | 194.05791 |
| SMILES | O=C(O)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C10H10O4/c11-9(12)6-10(13)14-7-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,12) |
| InChIKey | CFLAHQSWDKNWPW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(benzyloxy)-3-oxopropanoic acid (CHEBI:84093) has functional parent benzyl alcohol (CHEBI:17987) |
| 3-(benzyloxy)-3-oxopropanoic acid (CHEBI:84093) has functional parent malonic acid (CHEBI:30794) |
| 3-(benzyloxy)-3-oxopropanoic acid (CHEBI:84093) has role human urinary metabolite (CHEBI:84087) |
| 3-(benzyloxy)-3-oxopropanoic acid (CHEBI:84093) is a benzyl ester (CHEBI:90628) |
| 3-(benzyloxy)-3-oxopropanoic acid (CHEBI:84093) is a dicarboxylic acid monoester (CHEBI:36244) |
| IUPAC Name |
|---|
| 3-(benzyloxy)-3-oxopropanoic acid |
| Synonyms | Source |
|---|---|
| 2-benzyloxycarbonylacetic acid | ChEBI |
| benzyl hemimalonate | ChemIDplus |
| benzyl hydrogen malonate | ChemIDplus |
| mono-benzyl malonate | HMDB |
| monobenzyl malonate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0059721 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1960418 | Reaxys |
| CAS:40204-26-0 | ChemIDplus |