EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H33N5O |
| Net Charge | 0 |
| Average Mass | 419.573 |
| Monoisotopic Mass | 419.26851 |
| SMILES | [H][C@]1(NC[C@@H]2C=C3c4cccc5ncc(c45)C[C@@]3([H])N(C)C2)CN2CCN3CCC[C@@]3([H])[C@]2([H])O1 |
| InChI | InChI=1S/C25H33N5O/c1-28-14-16(10-19-18-4-2-5-20-24(18)17(13-26-20)11-22(19)28)12-27-23-15-30-9-8-29-7-3-6-21(29)25(30)31-23/h2,4-5,10,13,16,21-23,25-27H,3,6-9,11-12,14-15H2,1H3/t16-,21-,22+,23+,25-/m0/s1 |
| InChIKey | UDPQLCFGLBGHDF-IZKMSSHQSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ergotaman (CHEBI:36185) is a indole alkaloid (CHEBI:38958) |
| ergotaman (CHEBI:36185) is a indole alkaloid fundamental parent (CHEBI:38482) |
| Incoming Relation(s) |
| bromocriptine (CHEBI:3181) has parent hydride ergotaman (CHEBI:36185) |
| dihydro-α-ergocryptine (CHEBI:59919) has parent hydride ergotaman (CHEBI:36185) |
| dihydro-β-ergocryptine (CHEBI:59925) has parent hydride ergotaman (CHEBI:36185) |
| dihydroergocornine (CHEBI:59909) has parent hydride ergotaman (CHEBI:36185) |
| dihydroergocristine (CHEBI:59912) has parent hydride ergotaman (CHEBI:36185) |
| ergocornine (CHEBI:4820) has parent hydride ergotaman (CHEBI:36185) |
| ergocristine (CHEBI:4821) has parent hydride ergotaman (CHEBI:36185) |
| ergosine (CHEBI:4823) has parent hydride ergotaman (CHEBI:36185) |
| α-ergocryptine (CHEBI:10276) has parent hydride ergotaman (CHEBI:36185) |
| β-ergocryptine (CHEBI:59921) has parent hydride ergotaman (CHEBI:36185) |
| IUPAC Name |
|---|
| ergotaman |