EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H41N5O5 |
| Net Charge | 0 |
| Average Mass | 575.710 |
| Monoisotopic Mass | 575.31077 |
| SMILES | [H][C@@]12Cc3cnc4cccc(c34)C1=C[C@@H](C(=O)N[C@]1(C(C)C)O[C@]3(O)N(C1=O)[C@@H](C(C)CC)C(=O)N1CCC[C@]13[H])CN2C |
| InChI | InChI=1S/C32H41N5O5/c1-6-18(4)27-29(39)36-12-8-11-25(36)32(41)37(27)30(40)31(42-32,17(2)3)34-28(38)20-13-22-21-9-7-10-23-26(21)19(15-33-23)14-24(22)35(5)16-20/h7,9-10,13,15,17-18,20,24-25,27,33,41H,6,8,11-12,14,16H2,1-5H3,(H,34,38)/t18?,20-,24-,25+,27+,31-,32+/m1/s1 |
| InChIKey | YYWXOXLDOMRDHW-CZMPXICPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-ergocryptine (CHEBI:59921) has parent hydride ergotaman (CHEBI:36185) |
| β-ergocryptine (CHEBI:59921) is a ergot alkaloid (CHEBI:23943) |
| Incoming Relation(s) |
| dihydro-β-ergocryptine (CHEBI:59925) has functional parent β-ergocryptine (CHEBI:59921) |
| IUPAC Name |
|---|
| 5'α-(butan-2-yl)-12'-hydroxy-3',6',18-trioxo-2'-(propan-2-yl)ergotaman |
| Synonym | Source |
|---|---|
| 5'α(S)-sec-butyl-12'-hydroxy-2'-isopropylergotaman-3',6',18-trione | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| US2447214 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1066722 | Beilstein |
| CAS:20315-46-2 | ChemIDplus |