EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H40BrN5O5 |
| Net Charge | 0 |
| Average Mass | 654.606 |
| Monoisotopic Mass | 653.22128 |
| SMILES | [H][C@@]12Cc3c(Br)nc4cccc(c34)C1=C[C@@H](C(=O)N[C@]1(C(C)C)O[C@]3(O)N(C1=O)[C@@H](CC(C)C)C(=O)N1CCC[C@]13[H])CN2C |
| InChI | InChI=1S/C32H40BrN5O5/c1-16(2)12-24-29(40)37-11-7-10-25(37)32(42)38(24)30(41)31(43-32,17(3)4)35-28(39)18-13-20-19-8-6-9-22-26(19)21(27(33)34-22)14-23(20)36(5)15-18/h6,8-9,13,16-18,23-25,34,42H,7,10-12,14-15H2,1-5H3,(H,35,39)/t18-,23-,24+,25+,31-,32+/m1/s1 |
| InChIKey | OZVBMTJYIDMWIL-AYFBDAFISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | dopamine agonist A drug that binds to and activates dopamine receptors. anti-obesity agent Any substance which is used to reduce or control weight. hormone antagonist A chemical substance which inhibits the function of the endocrine glands, the biosynthesis of their secreted hormones, or the action of hormones upon their specific sites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | appetite enhancer A drug which increases appetite. hypoglycemic agent A drug which lowers the blood glucose level. dopamine agonist A drug that binds to and activates dopamine receptors. hormone antagonist A chemical substance which inhibits the function of the endocrine glands, the biosynthesis of their secreted hormones, or the action of hormones upon their specific sites. antiparkinson drug A drug used in the treatment of Parkinson's disease. antidyskinesia agent Any compound which can be used to treat or alleviate the symptoms of dyskinesia. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bromocriptine (CHEBI:3181) has parent hydride ergotaman (CHEBI:36185) |
| bromocriptine (CHEBI:3181) has role anti-obesity agent (CHEBI:74518) |
| bromocriptine (CHEBI:3181) has role antidyskinesia agent (CHEBI:66956) |
| bromocriptine (CHEBI:3181) has role antiparkinson drug (CHEBI:48407) |
| bromocriptine (CHEBI:3181) has role appetite enhancer (CHEBI:50779) |
| bromocriptine (CHEBI:3181) has role dopamine agonist (CHEBI:51065) |
| bromocriptine (CHEBI:3181) has role hormone antagonist (CHEBI:49020) |
| bromocriptine (CHEBI:3181) has role hypoglycemic agent (CHEBI:35526) |
| bromocriptine (CHEBI:3181) is a indole alkaloid (CHEBI:38958) |
| Incoming Relation(s) |
| bromocriptine methanesulfonate (CHEBI:3182) has part bromocriptine (CHEBI:3181) |
| IUPAC Name |
|---|
| (5'α)-2-bromo-12'-hydroxy-5'-(2-methylpropyl)-2'-(propan-2-yl)-3',6',18-trioxoergotaman |
| INNs | Source |
|---|---|
| bromocriptina | WHO MedNet |
| bromocriptine | ChemIDplus |
| bromocriptinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-bromo-.alpha.-ergocryptine | ChEMBL |
| 2-bromo-α-ergocryptine | Patent |
| 2-bromo-α-ergokryptin | ChemIDplus |
| 2-bromo-α-ergokryptine | ChemIDplus |
| (5'α)-2-bromo-12'-hydroxy-2'-(1-methylethyl)-5'-(2-methylpropyl)-3',6',18-trioxoergotaman | IUPAC |
| (5'α)-2-bromo-12'-hydroxy-2'-(1-methylethyl)-5'-(2-methylpropyl)ergotaman-3',6',18-trione | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:741357 | Beilstein |
| CAS:25614-03-3 | ChemIDplus |
| CAS:25614-03-3 | KEGG COMPOUND |
| Citations |
|---|