EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H41N5O5 |
| Net Charge | 0 |
| Average Mass | 611.743 |
| Monoisotopic Mass | 611.31077 |
| SMILES | [H][C@@]12Cc3cnc4cccc(c34)[C@@]1([H])C[C@@H](C(=O)N[C@]1(C(C)C)O[C@]3(O)N(C1=O)[C@@H](Cc1ccccc1)C(=O)N1CCC[C@]13[H])CN2C |
| InChI | InChI=1S/C35H41N5O5/c1-20(2)34(37-31(41)23-16-25-24-11-7-12-26-30(24)22(18-36-26)17-27(25)38(3)19-23)33(43)40-28(15-21-9-5-4-6-10-21)32(42)39-14-8-13-29(39)35(40,44)45-34/h4-7,9-12,18,20,23,25,27-29,36,44H,8,13-17,19H2,1-3H3,(H,37,41)/t23-,25-,27-,28+,29+,34-,35+/m1/s1 |
| InChIKey | DEQITUUQPICUMR-HJPBWRTMSA-N |
| Roles Classification |
|---|
| Biological Roles: | adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydroergocristine (CHEBI:59912) has functional parent ergocristine (CHEBI:4821) |
| dihydroergocristine (CHEBI:59912) has parent hydride ergotaman (CHEBI:36185) |
| dihydroergocristine (CHEBI:59912) has role adrenergic antagonist (CHEBI:37887) |
| dihydroergocristine (CHEBI:59912) has role vasodilator agent (CHEBI:35620) |
| dihydroergocristine (CHEBI:59912) is a ergot alkaloid (CHEBI:23943) |
| Incoming Relation(s) |
| dihydroergocristine mesylate (CHEBI:31490) has part dihydroergocristine (CHEBI:59912) |
| IUPAC Name |
|---|
| (10αH)-5'α-benzyl-12'-hydroxy-3',6',18-trioxo-2'-(propan-2-yl)-9,10-dihydroergotaman |
| Synonyms | Source |
|---|---|
| 9,10-dihydroergocristine | ChEBI |
| DHEC | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:79043 | Beilstein |
| CAS:17479-19-5 | KEGG DRUG |
| CAS:17479-19-5 | ChemIDplus |