EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H41N5O5 |
| Net Charge | 0 |
| Average Mass | 575.710 |
| Monoisotopic Mass | 575.31077 |
| SMILES | [H][C@@]12Cc3cnc4cccc(c34)C1=C[C@@H](C(=O)N[C@]1(C(C)C)O[C@]3(O)N(C1=O)[C@@H](CC(C)C)C(=O)N1CCC[C@]13[H])CN2C |
| InChI | InChI=1S/C32H41N5O5/c1-17(2)12-25-29(39)36-11-7-10-26(36)32(41)37(25)30(40)31(42-32,18(3)4)34-28(38)20-13-22-21-8-6-9-23-27(21)19(15-33-23)14-24(22)35(5)16-20/h6,8-9,13,15,17-18,20,24-26,33,41H,7,10-12,14,16H2,1-5H3,(H,34,38)/t20-,24-,25+,26+,31-,32+/m1/s1 |
| InChIKey | YDOTUXAWKBPQJW-NSLWYYNWSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-ergocryptine (CHEBI:10276) has parent hydride ergotaman (CHEBI:36185) |
| α-ergocryptine (CHEBI:10276) is a ergot alkaloid (CHEBI:23943) |
| Incoming Relation(s) |
| dihydro-α-ergocryptine (CHEBI:59919) has functional parent α-ergocryptine (CHEBI:10276) |
| IUPAC Name |
|---|
| 12'-hydroxy-5'α-(2-methylpropyl)-3',6',18-trioxo-2'-(propan-2-yl)ergotaman |
| Synonyms | Source |
|---|---|
| alpha-Ergocryptine | KEGG COMPOUND |
| 12'-hydroxy-5'α-isobutyl-2'-isopropylergotaman-3',6',18-trione | ChemIDplus |
| 12'-hydroxy-2'-(1-methylethyl)-5'α-(2-methylpropyl)ergotaman-3',6',18-trione | ChemIDplus |