EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H39N5O5 |
| Net Charge | 0 |
| Average Mass | 561.683 |
| Monoisotopic Mass | 561.29512 |
| SMILES | [H][C@@]12Cc3cnc4cccc(c34)C1=C[C@@H](C(=O)N[C@]1(C(C)C)O[C@]3(O)N(C1=O)[C@@H](C(C)C)C(=O)N1CCC[C@]13[H])CN2C |
| InChI | InChI=1S/C31H39N5O5/c1-16(2)26-28(38)35-11-7-10-24(35)31(40)36(26)29(39)30(41-31,17(3)4)33-27(37)19-12-21-20-8-6-9-22-25(20)18(14-32-22)13-23(21)34(5)15-19/h6,8-9,12,14,16-17,19,23-24,26,32,40H,7,10-11,13,15H2,1-5H3,(H,33,37)/t19-,23-,24+,26+,30-,31+/m1/s1 |
| InChIKey | UJYGDMFEEDNVBF-OGGGUQDZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ergocornine (CHEBI:4820) has parent hydride ergotaman (CHEBI:36185) |
| ergocornine (CHEBI:4820) is a ergot alkaloid (CHEBI:23943) |
| Incoming Relation(s) |
| dihydroergocornine (CHEBI:59909) has functional parent ergocornine (CHEBI:4820) |
| dihydroergocornine mesylate (CHEBI:34502) has functional parent ergocornine (CHEBI:4820) |
| IUPAC Name |
|---|
| 12'-hydroxy-3',6',18-trioxo-2',5'α-di(propan-2-yl)ergotaman |
| Synonyms | Source |
|---|---|
| Ergocornine | KEGG COMPOUND |
| 12'-hydroxy-2',5'α-bis(1-methylethyl)ergotaman-3',6',18-trione | ChemIDplus |