EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H37N5O5 |
| Net Charge | 0 |
| Average Mass | 547.656 |
| Monoisotopic Mass | 547.27947 |
| SMILES | [H][C@@]12Cc3cnc4cccc(c34)C1=C[C@@H](C(=O)N[C@]1(C)O[C@]3(O)N(C1=O)[C@@H](CC(C)C)C(=O)N1CCC[C@]13[H])CN2C |
| InChI | InChI=1S/C30H37N5O5/c1-16(2)11-23-27(37)34-10-6-9-24(34)30(39)35(23)28(38)29(3,40-30)32-26(36)18-12-20-19-7-5-8-21-25(19)17(14-31-21)13-22(20)33(4)15-18/h5,7-8,12,14,16,18,22-24,31,39H,6,9-11,13,15H2,1-4H3,(H,32,36)/t18-,22-,23+,24+,29-,30+/m1/s1 |
| InChIKey | NESVMZOPWPCFAU-ZPRCMDFASA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Epichloe typhina (ncbitaxon:5113) | - | PubMed (447932) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ergosine (CHEBI:4823) has parent hydride ergotaman (CHEBI:36185) |
| ergosine (CHEBI:4823) has role fungal metabolite (CHEBI:76946) |
| ergosine (CHEBI:4823) is a ergot alkaloid (CHEBI:23943) |
| IUPAC Name |
|---|
| (5'α)-12'-hydroxy-2'-methyl-5'-(2-methylpropyl)-3',6',18-trioxoergotaman |
| Synonyms | Source |
|---|---|
| (5'α)-12'-hydroxy-2'-methyl-5'-(2-methylpropyl)ergotaman-3',6',18-trione | ChemIDplus |
| (5'α)-12'-hydroxy-5'-isobutyl-2'-methyl-3',6',18-trioxoergotaman | IUPAC |
| Ergosine | KEGG COMPOUND |
| Citations |
|---|