EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H39N5O5 |
| Net Charge | 0 |
| Average Mass | 609.727 |
| Monoisotopic Mass | 609.29512 |
| SMILES | [H][C@@]12Cc3cnc4cccc(c34)C1=C[C@@H](C(=O)N[C@]1(C(C)C)O[C@]3(O)N(C1=O)[C@@H](Cc1ccccc1)C(=O)N1CCC[C@]13[H])CN2C |
| InChI | InChI=1S/C35H39N5O5/c1-20(2)34(37-31(41)23-16-25-24-11-7-12-26-30(24)22(18-36-26)17-27(25)38(3)19-23)33(43)40-28(15-21-9-5-4-6-10-21)32(42)39-14-8-13-29(39)35(40,44)45-34/h4-7,9-12,16,18,20,23,27-29,36,44H,8,13-15,17,19H2,1-3H3,(H,37,41)/t23-,27-,28+,29+,34-,35+/m1/s1 |
| InChIKey | HEFIYUQVAZFDEE-MKTPKCENSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ergocristine (CHEBI:4821) has parent hydride ergotaman (CHEBI:36185) |
| ergocristine (CHEBI:4821) is a ergot alkaloid (CHEBI:23943) |
| Incoming Relation(s) |
| dihydroergocristine (CHEBI:59912) has functional parent ergocristine (CHEBI:4821) |
| IUPAC Name |
|---|
| 5'α-benzyl-12'-hydroxy-3',6',18-trioxo-2'-(propan-2-yl)ergotaman |
| Synonyms | Source |
|---|---|
| ergocristine | ChEMBL |
| Ergocristine | KEGG COMPOUND |
| ergocrystine | NIST Chemistry WebBook |