EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:36096 - cyclohexanecarboxylic acid
| Formula | C7H12O2 |
| Net Charge | 0 |
| Average Mass | 128.171 |
| Monoisotopic Mass | 128.08373 |
| SMILES | O=C(O)C1CCCCC1 |
| InChI | InChI=1S/C7H12O2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2,(H,8,9) |
| InChIKey | NZNMSOFKMUBTKW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclohexanecarboxylic acid (CHEBI:36096) is a monocarboxylic acid (CHEBI:25384) |
| cyclohexanecarboxylic acid (CHEBI:36096) is conjugate acid of cyclohexanecarboxylate (CHEBI:27804) |
| Incoming Relation(s) |
| (1S,3R,4S)-3,4-dihydroxycyclohexane-1-carboxylic acid (CHEBI:15566) has functional parent cyclohexanecarboxylic acid (CHEBI:36096) |
| (1S,4S)-4-hydroxy-3-oxocyclohexane-1-carboxylic acid (CHEBI:15567) has functional parent cyclohexanecarboxylic acid (CHEBI:36096) |
| N-[5-(1-naphthylmethyl)-1,3-thiazol-2-yl]cyclohexanecarboxamide (CHEBI:76002) has functional parent cyclohexanecarboxylic acid (CHEBI:36096) |
| 1-amino-1-cyclohexanecarboxylic acid (CHEBI:86534) has functional parent cyclohexanecarboxylic acid (CHEBI:36096) |
| 2-hydroxy-4-isopropenylcyclohexanecarboxylic acid (CHEBI:37379) has functional parent cyclohexanecarboxylic acid (CHEBI:36096) |
| 2-hydroxycyclohexanecarboxylic acid (CHEBI:37377) has functional parent cyclohexanecarboxylic acid (CHEBI:36096) |
| 2-oxocyclohexanecarboxylic acid (CHEBI:37375) has functional parent cyclohexanecarboxylic acid (CHEBI:36096) |
| 4-hydroxycyclohexanecarboxylic acid (CHEBI:89341) has functional parent cyclohexanecarboxylic acid (CHEBI:36096) |
| 4-oxocyclohexanecarboxylic acid (CHEBI:1921) has functional parent cyclohexanecarboxylic acid (CHEBI:36096) |
| cyclohexane-1-carbonyl-CoA (CHEBI:28557) has functional parent cyclohexanecarboxylic acid (CHEBI:36096) |
| cyclohexanecarboxylate ester (CHEBI:50754) has functional parent cyclohexanecarboxylic acid (CHEBI:36096) |
| ethyl cyclohexanecarboxylate (CHEBI:88965) has functional parent cyclohexanecarboxylic acid (CHEBI:36096) |
| methyl cyclohexanecarboxylate (CHEBI:88845) has functional parent cyclohexanecarboxylic acid (CHEBI:36096) |
| tranexamic acid (CHEBI:48669) has functional parent cyclohexanecarboxylic acid (CHEBI:36096) |
| cyclohexanecarboxylate (CHEBI:27804) is conjugate base of cyclohexanecarboxylic acid (CHEBI:36096) |
| IUPAC Name |
|---|
| cyclohexanecarboxylic acid |
| Synonyms | Source |
|---|---|
| carboxycyclohexane | NIST Chemistry WebBook |
| Cyclohexancarbonsäure | ChEBI |
| Cyclohexane-1-carboxylate | KEGG COMPOUND |
| Cyclohexanecarboxylic acid | KEGG COMPOUND |
| cyclohexanoic acid | ChemIDplus |
| cyclohexylcarboxylic acid | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C00000334 | KNApSAcK |
| C09822 | KEGG COMPOUND |
| Cyclohexanecarboxylic_acid | Wikipedia |
| HMDB0031342 | HMDB |
| Citations |
|---|