EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13NO2 |
| Net Charge | 0 |
| Average Mass | 143.186 |
| Monoisotopic Mass | 143.09463 |
| SMILES | NC1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C7H13NO2/c8-7(6(9)10)4-2-1-3-5-7/h1-5,8H2,(H,9,10) |
| InChIKey | WOXWUZCRWJWTRT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-amino-1-cyclohexanecarboxylic acid (CHEBI:86534) has functional parent cyclohexanecarboxylic acid (CHEBI:36096) |
| 1-amino-1-cyclohexanecarboxylic acid (CHEBI:86534) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 1-aminocyclohexane-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| 1-aminocyclohexanecarboxylic acid | ChEBI |
| 1-azanylcyclohexane-1-carboxylic acid | ChEBI |
| α-aminocyclohexanecarboxylic aicd | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2355692 | Reaxys |
| CAS:2756-85-6 | ChemIDplus |
| Citations |
|---|