EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:48669 - tranexamic acid
| Formula | C8H15NO2 |
| Net Charge | 0 |
| Average Mass | 157.213 |
| Monoisotopic Mass | 157.11028 |
| SMILES | NC[C@H]1CC[C@H](C(=O)O)CC1 |
| InChI | InChI=1S/C8H15NO2/c9-5-6-1-3-7(4-2-6)8(10)11/h6-7H,1-5,9H2,(H,10,11)/t6-,7- |
| InChIKey | GYDJEQRTZSCIOI-LJGSYFOKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. vulnerary A drug used in treating and healing of wounds. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. anti-inflammatory agent Any compound that has anti-inflammatory effects. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. antifibrinolytic drug A drug that prevent fibrinolysis or lysis of a blood clot or thrombus. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. hepatoprotective agent Any compound that is able to prevent damage to the liver. hematologic agent Drug that acts on blood and blood-forming organs and those that affect the hemostatic system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tranexamic acid (CHEBI:48669) has functional parent cyclohexanecarboxylic acid (CHEBI:36096) |
| tranexamic acid (CHEBI:48669) has role analgesic (CHEBI:35480) |
| tranexamic acid (CHEBI:48669) has role anti-anaemic agent (CHEBI:75835) |
| tranexamic acid (CHEBI:48669) has role anti-inflammatory agent (CHEBI:67079) |
| tranexamic acid (CHEBI:48669) has role antifibrinolytic drug (CHEBI:48675) |
| tranexamic acid (CHEBI:48669) has role antineoplastic agent (CHEBI:35610) |
| tranexamic acid (CHEBI:48669) has role antiviral agent (CHEBI:22587) |
| tranexamic acid (CHEBI:48669) has role cardiovascular drug (CHEBI:35554) |
| tranexamic acid (CHEBI:48669) has role gastrointestinal drug (CHEBI:55324) |
| tranexamic acid (CHEBI:48669) has role hematologic agent (CHEBI:50248) |
| tranexamic acid (CHEBI:48669) has role hepatoprotective agent (CHEBI:62868) |
| tranexamic acid (CHEBI:48669) has role neuroprotective agent (CHEBI:63726) |
| tranexamic acid (CHEBI:48669) has role vulnerary (CHEBI:73336) |
| tranexamic acid (CHEBI:48669) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| trans-4-(aminomethyl)cyclohexanecarboxylic acid |
| INNs | Source |
|---|---|
| acide tranéxamique | ChemIDplus |
| ácido tranexámico | ChemIDplus |
| acidum tranexamicum | ChemIDplus |
| tranexamic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| Amcha | ChEMBL |
| CL 65336 | ChEMBL |
| CL-65336 | ChEMBL |
| CL65336 | ChEMBL |
| Cyclo-f | ChEMBL |
| Cyclokapron | ChEMBL |
| Brand Names | Source |
|---|---|
| Cyklo-f heavy period relief | ChEMBL |
| Cyklokapron | KEGG DRUG |
| Exacyl | ChEMBL |
| Lysteda | ChEMBL |
| Menstralite | ChEMBL |
| Citations |
|---|