EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO2 |
| Net Charge | 0 |
| Average Mass | 157.213 |
| Monoisotopic Mass | 157.11028 |
| SMILES | NC[C@H]1CC[C@H](C(=O)O)CC1 |
| InChI | InChI=1S/C8H15NO2/c9-5-6-1-3-7(4-2-6)8(10)11/h6-7H,1-5,9H2,(H,10,11)/t6-,7- |
| InChIKey | GYDJEQRTZSCIOI-LJGSYFOKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | antifibrinolytic drug A drug that prevent fibrinolysis or lysis of a blood clot or thrombus. hematologic agent Drug that acts on blood and blood-forming organs and those that affect the hemostatic system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tranexamic acid (CHEBI:48669) has functional parent cyclohexanecarboxylic acid (CHEBI:36096) |
| tranexamic acid (CHEBI:48669) has role antifibrinolytic drug (CHEBI:48675) |
| tranexamic acid (CHEBI:48669) has role hematologic agent (CHEBI:50248) |
| tranexamic acid (CHEBI:48669) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| trans-4-(aminomethyl)cyclohexanecarboxylic acid |
| INNs | Source |
|---|---|
| acide tranéxamique | ChemIDplus |
| ácido tranexámico | ChemIDplus |
| acidum tranexamicum | ChemIDplus |
| tranexamic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| Tranexamic acid | KEGG DRUG |
| Tranexamsaeure | ChemIDplus |
| tranexmic acid | DrugBank |
| Tranhexamic acid | DrugBank |
| TRANS-4-AMINOMETHYLCYCLOHEXANE-1-CARBOXYLIC ACID | PDBeChem |
| trans-4-(aminomethyl)cyclohexanecarboxylic acid | ChemIDplus |
| Brand Name | Source |
|---|---|
| Cyklokapron | KEGG DRUG |