EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O3 |
| Net Charge | 0 |
| Average Mass | 142.154 |
| Monoisotopic Mass | 142.06299 |
| SMILES | O=C(O)C1CCCCC1=O |
| InChI | InChI=1S/C7H10O3/c8-6-4-2-1-3-5(6)7(9)10/h5H,1-4H2,(H,9,10) |
| InChIKey | POROIMOHDIEBBO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxocyclohexanecarboxylic acid (CHEBI:37375) has functional parent cyclohexanecarboxylic acid (CHEBI:36096) |
| 2-oxocyclohexanecarboxylic acid (CHEBI:37375) is a oxo monocarboxylic acid (CHEBI:35871) |
| Incoming Relation(s) |
| 2-oxocyclohexane-1-carbonyl-CoA (CHEBI:27664) has functional parent 2-oxocyclohexanecarboxylic acid (CHEBI:37375) |
| IUPAC Name |
|---|
| 2-oxocyclohexanecarboxylic acid |
| Synonyms | Source |
|---|---|
| 2-carboxycyclohexanone | ChEBI |
| 2-ketocyclohexanecarboxylic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:774819 | Beilstein |