EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11O2 |
| Net Charge | -1 |
| Average Mass | 127.163 |
| Monoisotopic Mass | 127.07645 |
| SMILES | O=C([O-])C1CCCCC1 |
| InChI | InChI=1S/C7H12O2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2,(H,8,9)/p-1 |
| InChIKey | NZNMSOFKMUBTKW-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclohexanecarboxylate (CHEBI:27804) is a monocarboxylic acid anion (CHEBI:35757) |
| cyclohexanecarboxylate (CHEBI:27804) is conjugate base of cyclohexanecarboxylic acid (CHEBI:36096) |
| Incoming Relation(s) |
| 4-hydroxycyclohexanecarboxylate (CHEBI:747087) has functional parent cyclohexanecarboxylate (CHEBI:27804) |
| 4-oxocyclohexanecarboxylate (CHEBI:15777) has functional parent cyclohexanecarboxylate (CHEBI:27804) |
| cyclohexanecarboxylic acid (CHEBI:36096) is conjugate acid of cyclohexanecarboxylate (CHEBI:27804) |
| IUPAC Name |
|---|
| cyclohexanecarboxylate |
| Synonym | Source |
|---|---|
| cyclohexanecarboxylic acid, ion(1−) | ChemIDplus |
| UniProt Name | Source |
|---|---|
| cyclohexane-1-carboxylate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:325917 | Gmelin |
| Reaxys:3904573 | Reaxys |
| CAS:3198-23-0 | ChemIDplus |