EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O3 |
| Net Charge | 0 |
| Average Mass | 184.235 |
| Monoisotopic Mass | 184.10994 |
| SMILES | C=C(C)C1CCC(C(=O)O)C(O)C1 |
| InChI | InChI=1S/C10H16O3/c1-6(2)7-3-4-8(10(12)13)9(11)5-7/h7-9,11H,1,3-5H2,2H3,(H,12,13) |
| InChIKey | MYINPIFJBYJQKQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-4-isopropenylcyclohexanecarboxylic acid (CHEBI:37379) has functional parent cyclohexanecarboxylic acid (CHEBI:36096) |
| 2-hydroxy-4-isopropenylcyclohexanecarboxylic acid (CHEBI:37379) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| Incoming Relation(s) |
| 2-hydroxy-4-isopropenylcyclohexane-1-carbonyl-CoA (CHEBI:29473) has functional parent 2-hydroxy-4-isopropenylcyclohexanecarboxylic acid (CHEBI:37379) |
| IUPAC Name |
|---|
| 2-hydroxy-4-(prop-1-en-2-yl)cyclohexanecarboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2720185 | Beilstein |