EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12O3 |
| Net Charge | 0 |
| Average Mass | 144.170 |
| Monoisotopic Mass | 144.07864 |
| SMILES | O=C(O)C1CCC(O)CC1 |
| InChI | InChI=1S/C7H12O3/c8-6-3-1-5(2-4-6)7(9)10/h5-6,8H,1-4H2,(H,9,10) |
| InChIKey | HCFRWBBJISAZNK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (1245069 ) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxycyclohexanecarboxylic acid (CHEBI:89341) has functional parent cyclohexanecarboxylic acid (CHEBI:36096) |
| 4-hydroxycyclohexanecarboxylic acid (CHEBI:89341) has role human urinary metabolite (CHEBI:84087) |
| 4-hydroxycyclohexanecarboxylic acid (CHEBI:89341) is a 4-hydroxy monocarboxylic acid (CHEBI:35970) |
| 4-hydroxycyclohexanecarboxylic acid (CHEBI:89341) is conjugate acid of 4-hydroxycyclohexanecarboxylate (CHEBI:747087) |
| Incoming Relation(s) |
| trans-4-hydroxycyclohexanecarboxylic acid (CHEBI:16817) is a 4-hydroxycyclohexanecarboxylic acid (CHEBI:89341) |
| 4-hydroxycyclohexanecarboxylate (CHEBI:747087) is conjugate base of 4-hydroxycyclohexanecarboxylic acid (CHEBI:89341) |
| IUPAC Name |
|---|
| 4-hydroxycyclohexanecarboxylic acid |
| Synonyms | Source |
|---|---|
| 4-hydroxycyclohexane-1-carboxylic acid | IUPAC |
| 4-hydroxycyclohexylcarboxylic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| FDB022785 | FooDB |
| HMDB0001988 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:17419-81-7 | ChEBI |
| Citations |
|---|