EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:88965 - ethyl cyclohexanecarboxylate
| Formula | C9H16O2 |
| Net Charge | 0 |
| Average Mass | 156.225 |
| Monoisotopic Mass | 156.11503 |
| SMILES | CCOC(=O)C1CCCCC1 |
| InChI | InChI=1S/C9H16O2/c1-2-11-9(10)8-6-4-3-5-7-8/h8H,2-7H2,1H3 |
| InChIKey | JJOYCHKVKWDMEA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | faeces (UBERON:0001988) | PubMed (23454028) | |
| Olea europaea (ncbitaxon:4146) | - | PubMed (24295708) |
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl cyclohexanecarboxylate (CHEBI:88965) has functional parent cyclohexanecarboxylic acid (CHEBI:36096) |
| ethyl cyclohexanecarboxylate (CHEBI:88965) has role flavouring agent (CHEBI:35617) |
| ethyl cyclohexanecarboxylate (CHEBI:88965) has role human metabolite (CHEBI:77746) |
| ethyl cyclohexanecarboxylate (CHEBI:88965) has role plant metabolite (CHEBI:76924) |
| ethyl cyclohexanecarboxylate (CHEBI:88965) is a ethyl ester (CHEBI:23990) |
| ethyl cyclohexanecarboxylate (CHEBI:88965) is a volatile organic compound (CHEBI:134179) |
| IUPAC Name |
|---|
| ethyl cyclohexanecarboxylate |
| Synonyms | Source |
|---|---|
| ethyl cyclohexanoate | HMDB |
| cyclohexanecarboxylic acid, ethyl ester | ChemIDplus |
| ethoxycarbonylcyclohexane | ChemIDplus |
| ethyl cyclohexylmethanoate | HMDB |
| ethyl cyclohexylcarboxylate | ChemIDplus |
| ethyl cyclohexanocarboxylate | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033167 | HMDB |
| FDB011176 | FooDB |
| 17646 | ChemSpider |
| Citations |
|---|