EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:18300 - maleic acid
| Formula | C4H4O4 |
| Net Charge | 0 |
| Average Mass | 116.072 |
| Monoisotopic Mass | 116.01096 |
| SMILES | O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1- |
| InChIKey | VZCYOOQTPOCHFL-UPHRSURJSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | PubMed (10952545) | |
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| maleic acid (CHEBI:18300) has role algal metabolite (CHEBI:84735) |
| maleic acid (CHEBI:18300) has role mouse metabolite (CHEBI:75771) |
| maleic acid (CHEBI:18300) has role plant metabolite (CHEBI:76924) |
| maleic acid (CHEBI:18300) is a butenedioic acid (CHEBI:22958) |
| maleic acid (CHEBI:18300) is conjugate acid of maleate (CHEBI:132951) |
| maleic acid (CHEBI:18300) is conjugate acid of maleate(1−) (CHEBI:37156) |
| Incoming Relation(s) |
| N-formylmaleamic acid (CHEBI:59930) has functional parent maleic acid (CHEBI:18300) |
| 2-(ω-methylthio)alkylmaleic acid (CHEBI:134534) has functional parent maleic acid (CHEBI:18300) |
| 2-isopropylmaleic acid (CHEBI:17275) has functional parent maleic acid (CHEBI:18300) |
| citraconic acid (CHEBI:17626) has functional parent maleic acid (CHEBI:18300) |
| dimethylmaleic acid (CHEBI:23812) has functional parent maleic acid (CHEBI:18300) |
| maleamic acid (CHEBI:29045) has functional parent maleic acid (CHEBI:18300) |
| maleate ester (CHEBI:35486) has functional parent maleic acid (CHEBI:18300) |
| maleimide (CHEBI:16072) has functional parent maleic acid (CHEBI:18300) |
| maleimides (CHEBI:55417) has functional parent maleic acid (CHEBI:18300) |
| maleate (CHEBI:132951) is conjugate base of maleic acid (CHEBI:18300) |
| maleate(1−) (CHEBI:37156) is conjugate base of maleic acid (CHEBI:18300) |
| (Z)-3-carboxyprop-2-enoyl group (CHEBI:25122) is substituent group from maleic acid (CHEBI:18300) |
| maleoyl group (CHEBI:25121) is substituent group from maleic acid (CHEBI:18300) |
| IUPAC Name |
|---|
| (2Z)-but-2-enedioic acid |
| Synonyms | Source |
|---|---|
| Maleic acid | KEGG COMPOUND |
| cis-Butenedioic acid | KEGG COMPOUND |
| cis-but-2-enedioic acid | IUPAC |
| H2male | IUPAC |
| (Z)-2-butenedioic acid | NIST Chemistry WebBook |
| (Z)-butenedioic acid | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C01384 | KEGG COMPOUND |
| C01384 | KEGG COMPOUND |
| MAE | PDBeChem |
| DB04299 | DrugBank |
| HMDB0000176 | HMDB |
| MALEATE | MetaCyc |
| Maleic_acid | Wikipedia |
| C00007417 | KNApSAcK |
| Citations |
|---|