EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O4 |
| Net Charge | 0 |
| Average Mass | 130.099 |
| Monoisotopic Mass | 130.02661 |
| SMILES | C/C(=C/C(=O)O)C(=O)O |
| InChI | InChI=1S/C5H6O4/c1-3(5(8)9)2-4(6)7/h2H,1H3,(H,6,7)(H,8,9)/b3-2- |
| InChIKey | HNEGQIOMVPPMNR-IHWYPQMZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| citraconic acid (CHEBI:17626) has functional parent maleic acid (CHEBI:18300) |
| citraconic acid (CHEBI:17626) has role human metabolite (CHEBI:77746) |
| citraconic acid (CHEBI:17626) is a dicarboxylic acid (CHEBI:35692) |
| citraconic acid (CHEBI:17626) is a dicarboxylic fatty acid (CHEBI:189840) |
| citraconic acid (CHEBI:17626) is conjugate acid of citraconate(2−) (CHEBI:30719) |
| Incoming Relation(s) |
| citraconate(2−) (CHEBI:30719) is conjugate base of citraconic acid (CHEBI:17626) |
| IUPAC Name |
|---|
| (2Z)-2-methylbut-2-enedioic acid |
| Synonyms | Source |
|---|---|
| 2-Methyl-2-butenedioic acid | NIST Chemistry WebBook |
| 2-methylmaleic acid | ChEBI |
| cis-Methylbutenedioic acid | ChemIDplus |
| Citraconic acid | KEGG COMPOUND |
| Citraconic acid | ChemIDplus |
| Citraconsäure | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2-METHYLMALEATE | MetaCyc |
| C02226 | KEGG COMPOUND |
| Citraconic_acid | Wikipedia |
| DB04734 | DrugBank |
| HMDB0000634 | HMDB |
| Citations |
|---|