EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O4 |
| Net Charge | 0 |
| Average Mass | 144.126 |
| Monoisotopic Mass | 144.04226 |
| SMILES | C/C(C(=O)O)=C(\C)C(=O)O |
| InChI | InChI=1S/C6H8O4/c1-3(5(7)8)4(2)6(9)10/h1-2H3,(H,7,8)(H,9,10)/b4-3- |
| InChIKey | CGBYBGVMDAPUIH-ARJAWSKDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethylmaleic acid (CHEBI:23812) has functional parent maleic acid (CHEBI:18300) |
| dimethylmaleic acid (CHEBI:23812) is a dicarboxylic acid (CHEBI:35692) |
| dimethylmaleic acid (CHEBI:23812) is conjugate acid of dimethylmaleate(2−) (CHEBI:17081) |
| Incoming Relation(s) |
| dimethylmaleate(2−) (CHEBI:17081) is conjugate base of dimethylmaleic acid (CHEBI:23812) |
| IUPAC Name |
|---|
| (2Z)-2,3-dimethylbut-2-enedioic acid |
| Synonyms | Source |
|---|---|
| Dimethylmaleic acid | KEGG COMPOUND |
| alpha,beta-Dimethylmaleic acid | ChemIDplus |
| 2,3-dimethylmaleic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00922 | KEGG COMPOUND |
| DIMETHYLMAL-CPD | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1723592 | Reaxys |
| CAS:488-21-1 | KEGG COMPOUND |
| CAS:488-21-1 | ChemIDplus |
| Citations |
|---|