EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4O4 |
| Net Charge | 0 |
| Average Mass | 116.072 |
| Monoisotopic Mass | 116.01096 |
| SMILES | [H]C(C(=O)O)=C([H])C(=O)O |
| InChI | InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8) |
| InChIKey | VZCYOOQTPOCHFL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butenedioic acid (CHEBI:22958) is a C4-dicarboxylic acid (CHEBI:66873) |
| butenedioic acid (CHEBI:22958) is conjugate acid of hydrogen butenedioate (CHEBI:37155) |
| Incoming Relation(s) |
| enol-oxaloacetic acid (CHEBI:28394) has functional parent butenedioic acid (CHEBI:22958) |
| 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioic acid (CHEBI:19448) has functional parent butenedioic acid (CHEBI:22958) |
| fumaric acid (CHEBI:18012) is a butenedioic acid (CHEBI:22958) |
| maleic acid (CHEBI:18300) is a butenedioic acid (CHEBI:22958) |
| hydrogen butenedioate (CHEBI:37155) is conjugate base of butenedioic acid (CHEBI:22958) |
| 3-carboxyprop-2-enoyl group (CHEBI:37953) is substituent group from butenedioic acid (CHEBI:22958) |
| butenedioyl group (CHEBI:37954) is substituent group from butenedioic acid (CHEBI:22958) |
| IUPAC Name |
|---|
| but-2-enedioic acid |
| Synonym | Source |
|---|---|
| 2-butenedioic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8132074 | Beilstein |