EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (CH2)n.C6H8O4S |
| Net Charge | 0 |
| Average Mass | 190.220 |
| Monoisotopic Mass | 190.02998 |
| SMILES | CSCC/C(=C/C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H10O4S/c1-12-3-2-5(7(10)11)4-6(8)9/h4H,2-3H2,1H3,(H,8,9)(H,10,11)/b5-4- |
| InChIKey | FCGNCJNTFRMBQY-PLNGDYQASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(ω-methylthio)alkylmaleic acid (CHEBI:134534) has functional parent maleic acid (CHEBI:18300) |
| 2-(ω-methylthio)alkylmaleic acid (CHEBI:134534) is a dicarboxylic acid (CHEBI:35692) |
| 2-(ω-methylthio)alkylmaleic acid (CHEBI:134534) is a methyl sulfide (CHEBI:86315) |
| 2-(ω-methylthio)alkylmaleic acid (CHEBI:134534) is a olefinic compound (CHEBI:78840) |
| 2-(ω-methylthio)alkylmaleic acid (CHEBI:134534) is a sulfur-containing carboxylic acid (CHEBI:33576) |
| 2-(ω-methylthio)alkylmaleic acid (CHEBI:134534) is conjugate acid of 2-(ω-methylthio)alkylmaleate(2−) (CHEBI:133498) |
| Incoming Relation(s) |
| 2-(2-methylthio)ethylmaleic acid (CHEBI:134535) is a 2-(ω-methylthio)alkylmaleic acid (CHEBI:134534) |
| 2-(2-methylthiopropyl)maleic acid (CHEBI:134536) is a 2-(ω-methylthio)alkylmaleic acid (CHEBI:134534) |
| 2-(ω-methylthio)alkylmaleate(2−) (CHEBI:133498) is conjugate base of 2-(ω-methylthio)alkylmaleic acid (CHEBI:134534) |
| Synonym | Source |
|---|---|
| 2-(ω-methylthio)alkylmaleic acids | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-19484 | MetaCyc |