EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5NO4 |
| Net Charge | 0 |
| Average Mass | 143.098 |
| Monoisotopic Mass | 143.02186 |
| SMILES | O=CNC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C5H5NO4/c7-3-6-4(8)1-2-5(9)10/h1-3H,(H,9,10)(H,6,7,8)/b2-1- |
| InChIKey | HSKSAKBZUITULZ-UPHRSURJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-formylmaleamic acid (CHEBI:59930) has functional parent maleic acid (CHEBI:18300) |
| N-formylmaleamic acid (CHEBI:59930) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| N-formylmaleamic acid (CHEBI:59930) is conjugate acid of N-formylmaleamate (CHEBI:59911) |
| Incoming Relation(s) |
| N-formylmaleamate (CHEBI:59911) is conjugate base of N-formylmaleamic acid (CHEBI:59930) |
| IUPAC Name |
|---|
| (2Z)-4-formamido-4-oxobut-2-enoic acid |
| Synonym | Source |
|---|---|
| (Z)-4-formamido-4-oxobut-2-enoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C18232 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2205367 | Beilstein |