EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O4 |
| Net Charge | 0 |
| Average Mass | 158.153 |
| Monoisotopic Mass | 158.05791 |
| SMILES | CC(C)/C(=C/C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H10O4/c1-4(2)5(7(10)11)3-6(8)9/h3-4H,1-2H3,(H,8,9)(H,10,11)/b5-3- |
| InChIKey | NJMGRJLQRLFQQX-HYXAFXHYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-isopropylmaleic acid (CHEBI:17275) has functional parent maleic acid (CHEBI:18300) |
| 2-isopropylmaleic acid (CHEBI:17275) has role Escherichia coli metabolite (CHEBI:76971) |
| 2-isopropylmaleic acid (CHEBI:17275) is a dicarboxylic acid (CHEBI:35692) |
| 2-isopropylmaleic acid (CHEBI:17275) is conjugate acid of 2-isopropylmaleate(2−) (CHEBI:58085) |
| Incoming Relation(s) |
| 2-isopropylmaleate(2−) (CHEBI:58085) is conjugate base of 2-isopropylmaleic acid (CHEBI:17275) |
| IUPAC Name |
|---|
| (2Z)-2-(propan-2-yl)but-2-enedioic acid |
| Synonyms | Source |
|---|---|
| 2-Isopropylmaleate | KEGG COMPOUND |
| beta-Isopropylmaleate | KEGG COMPOUND |