EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H3O4 |
| Net Charge | -1 |
| Average Mass | 115.064 |
| Monoisotopic Mass | 115.00368 |
| SMILES | O=C([O-])/C=C\C(=O)O |
| InChI | InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/p-1/b2-1- |
| InChIKey | VZCYOOQTPOCHFL-UPHRSURJSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| maleate(1−) (CHEBI:37156) is a hydrogen butenedioate (CHEBI:37155) |
| maleate(1−) (CHEBI:37156) is a maleate (CHEBI:132951) |
| maleate(1−) (CHEBI:37156) is conjugate acid of maleate(2−) (CHEBI:30780) |
| maleate(1−) (CHEBI:37156) is conjugate base of maleic acid (CHEBI:18300) |
| Incoming Relation(s) |
| maleic acid (CHEBI:18300) is conjugate acid of maleate(1−) (CHEBI:37156) |
| maleate(2−) (CHEBI:30780) is conjugate base of maleate(1−) (CHEBI:37156) |
| IUPAC Name |
|---|
| (2Z)-3-carboxyprop-2-enoate |
| Synonyms | Source |
|---|---|
| (2Z)-3-carboxyacrylate | IUPAC |
| Hmale | IUPAC |
| hydrogen maleate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:325289 | Gmelin |
| Reaxys:3537457 | Reaxys |