EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO2S |
| Net Charge | 0 |
| Average Mass | 135.188 |
| Monoisotopic Mass | 135.03540 |
| SMILES | N[C@@H](CCS)C(=O)O |
| InChI | InChI=1S/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7)/t3-/m0/s1 |
| InChIKey | FFFHZYDWPBMWHY-VKHMYHEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-homocysteine (CHEBI:17588) has role mouse metabolite (CHEBI:75771) |
| L-homocysteine (CHEBI:17588) is a homocysteine (CHEBI:17230) |
| L-homocysteine (CHEBI:17588) is a serine family amino acid (CHEBI:26650) |
| L-homocysteine (CHEBI:17588) is conjugate acid of L-homocysteinate (CHEBI:63072) |
| L-homocysteine (CHEBI:17588) is tautomer of L-homocysteine zwitterion (CHEBI:58199) |
| Incoming Relation(s) |
| N6-(L-homocysteinyl)-L-lysyl-L-alanine (CHEBI:61874) has functional parent L-homocysteine (CHEBI:17588) |
| S-(5-deoxy-β-D-ribos-5-yl)-L-homocysteine (CHEBI:90364) has functional parent L-homocysteine (CHEBI:17588) |
| L-homocysteine thiolactone (CHEBI:60315) has functional parent L-homocysteine (CHEBI:17588) |
| L-homolanthionine (CHEBI:62856) has functional parent L-homocysteine (CHEBI:17588) |
| L,L-homocystine (CHEBI:141698) has functional parent L-homocysteine (CHEBI:17588) |
| L-homocysteinate (CHEBI:63072) is conjugate base of L-homocysteine (CHEBI:17588) |
| L-homocysteine zwitterion (CHEBI:58199) is tautomer of L-homocysteine (CHEBI:17588) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-sulfanylbutanoic acid |
| Synonyms | Source |
|---|---|
| Hcy | ChEBI |
| L-2-amino-4-mercaptobutyric acid | ChEBI |
| L-2-Amino-4-mercaptobutyric acid | KEGG COMPOUND |
| L-homocysteine | ChEBI |
| L-Homocysteine | KEGG COMPOUND |
| Citations |
|---|