EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NOS |
| Net Charge | 0 |
| Average Mass | 117.173 |
| Monoisotopic Mass | 117.02483 |
| SMILES | N[C@H]1CCSC1=O |
| InChI | InChI=1S/C4H7NOS/c5-3-1-2-7-4(3)6/h3H,1-2,5H2/t3-/m0/s1 |
| InChIKey | KIWQWJKWBHZMDT-VKHMYHEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-homocysteine thiolactone (CHEBI:60315) has functional parent L-homocysteine (CHEBI:17588) |
| L-homocysteine thiolactone (CHEBI:60315) has role human metabolite (CHEBI:77746) |
| L-homocysteine thiolactone (CHEBI:60315) is a tetrahydrothiophenes (CHEBI:48224) |
| L-homocysteine thiolactone (CHEBI:60315) is a thiolactone (CHEBI:60317) |
| L-homocysteine thiolactone (CHEBI:60315) is conjugate base of L-homocysteine thiolactone(1+) (CHEBI:233452) |
| Incoming Relation(s) |
| L-homocysteine thiolactone(1+) (CHEBI:233452) is conjugate acid of L-homocysteine thiolactone (CHEBI:60315) |
| IUPAC Name |
|---|
| (3S)-3-aminodihydrothiophen-2(3H)-one |
| Synonyms | Source |
|---|---|
| homocysteine thiolactone | ChEBI |
| (S)-3-aminodihydro-2(3H)-thiophenone | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:80591 | Beilstein |
| CAS:2338-04-7 | ChemIDplus |
| Citations |
|---|