EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO2S |
| Net Charge | 0 |
| Average Mass | 135.188 |
| Monoisotopic Mass | 135.03540 |
| SMILES | NC(CCS)C(=O)O |
| InChI | InChI=1S/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7) |
| InChIKey | FFFHZYDWPBMWHY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (17024318) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| homocysteine (CHEBI:17230) has role fundamental metabolite (CHEBI:78675) |
| homocysteine (CHEBI:17230) is a homocysteines (CHEBI:24610) |
| homocysteine (CHEBI:17230) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| homocysteine (CHEBI:17230) is a sulfur-containing amino acid (CHEBI:26834) |
| homocysteine (CHEBI:17230) is conjugate acid of homocysteinate (CHEBI:66952) |
| homocysteine (CHEBI:17230) is tautomer of homocysteine zwitterion (CHEBI:58065) |
| Incoming Relation(s) |
| homocysteic acid (CHEBI:90324) has functional parent homocysteine (CHEBI:17230) |
| homocysteine derivative (CHEBI:136505) has functional parent homocysteine (CHEBI:17230) |
| L-homocysteine (CHEBI:17588) is a homocysteine (CHEBI:17230) |
| homocysteinate (CHEBI:66952) is conjugate base of homocysteine (CHEBI:17230) |
| homocysteine zwitterion (CHEBI:58065) is tautomer of homocysteine (CHEBI:17230) |
| IUPAC Names |
|---|
| 2-amino-4-sulfanylbutanoic acid |
| homocysteine |
| Synonyms | Source |
|---|---|
| 2-Amino-4-mercaptobutyric acid | KEGG COMPOUND |
| Hcy | IUPAC |
| Homocysteine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05330 | KEGG COMPOUND |
| HMDB0000742 | HMDB |
| Homocysteine | Wikipedia |
| Citations |
|---|