EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O4S |
| Net Charge | 0 |
| Average Mass | 236.293 |
| Monoisotopic Mass | 236.08308 |
| SMILES | N[C@@H](CCSCC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H16N2O4S/c9-5(7(11)12)1-3-15-4-2-6(10)8(13)14/h5-6H,1-4,9-10H2,(H,11,12)(H,13,14)/t5-,6-/m0/s1 |
| InChIKey | MBEPFGPQVBIIES-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-homolanthionine (CHEBI:62856) has functional parent L-homocysteine (CHEBI:17588) |
| L-homolanthionine (CHEBI:62856) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-homolanthionine (CHEBI:62856) is a organic sulfide (CHEBI:16385) |
| L-homolanthionine (CHEBI:62856) is a sulfur-containing amino acid (CHEBI:26834) |
| L-homolanthionine (CHEBI:62856) is tautomer of L-homolanthionine dizwitterion (CHEBI:178194) |
| Incoming Relation(s) |
| L-homolanthionine dizwitterion (CHEBI:178194) is tautomer of L-homolanthionine (CHEBI:62856) |
| IUPAC Names |
|---|
| S-[(3S)-3-amino-3-carboxypropyl]-L-homocysteine |
| (2S,2'S)-4,4'-sulfanediylbis(2-aminobutanoic acid) |
| Synonyms | Source |
|---|---|
| homolanthionine | SUBMITTER |
| (S,S)-2,2'-diamino-4,4'-sulfanediyldibutyric acid | ChEBI |
| L-homolanthionin | ChEBI |
| L-4,4'-thiobis[2-aminobutanoic acid] | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002034 | HMDB |
| FDB022810 | FooDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728128 | Reaxys |
| CAS:31982-10-2 | HMDB |
| Citations |
|---|