EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O4S2 |
| Net Charge | 0 |
| Average Mass | 268.360 |
| Monoisotopic Mass | 268.05515 |
| SMILES | N[C@@H](CCSSCC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H16N2O4S2/c9-5(7(11)12)1-3-15-16-4-2-6(10)8(13)14/h5-6H,1-4,9-10H2,(H,11,12)(H,13,14)/t5-,6-/m0/s1 |
| InChIKey | ZTVZLYBCZNMWCF-WDSKDSINSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L,L-homocystine (CHEBI:141698) has functional parent L-homocysteine (CHEBI:17588) |
| L,L-homocystine (CHEBI:141698) is a homocystine (CHEBI:17485) |
| L,L-homocystine (CHEBI:141698) is tautomer of L,L-homocystine zwitterion (CHEBI:140613) |
| Incoming Relation(s) |
| L,L-homocystine zwitterion (CHEBI:140613) is tautomer of L,L-homocystine (CHEBI:141698) |
| IUPAC Name |
|---|
| (2S,2'S)-4,4'-dithiobis(2-aminobutanoic acid) |
| Synonyms | Source |
|---|---|
| L-homocystine | ChemIDplus |
| L-4,4'-dithio-bis(2-aminobutanoic acid) | ChEBI |
| (2S)-2-amino-4-{[(3S)-3-amino-3-carboxypropyl]disulfanyl}butanoic acid | ChEBI |
| L-4,4'-dithio-bis(2-aminobutyric acid) | ChEBI |
| (2S,2'S)-4,4'-dithiobis(2-aminobutyric acid) | ChEBI |
| L-4,4'-dithiobis(2-aminobutanoic acid) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HOMOCYSTINE | MetaCyc |
| C01817 | KEGG COMPOUND |
| HMDB0000676 | HMDB |
| FDB022176 | FooDB |
| Homocystine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728583 | Reaxys |
| CAS:626-72-2 | ChemIDplus |
| Citations |
|---|