EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17NO6S |
| Net Charge | 0 |
| Average Mass | 267.303 |
| Monoisotopic Mass | 267.07766 |
| SMILES | N[C@@H](CCSC[C@H]1O[C@@H](O)[C@H](O)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C9H17NO6S/c10-4(8(13)14)1-2-17-3-5-6(11)7(12)9(15)16-5/h4-7,9,11-12,15H,1-3,10H2,(H,13,14)/t4-,5+,6+,7+,9+/m0/s1 |
| InChIKey | IQFWYNFDWRYSRA-OEQWSMLSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli BL21 (ncbitaxon:511693) | - | PubMed (24967680) | Strain: BL21 |
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS225) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-(5-deoxy-β-D-ribos-5-yl)-L-homocysteine (CHEBI:90364) has functional parent L-homocysteine (CHEBI:17588) |
| S-(5-deoxy-β-D-ribos-5-yl)-L-homocysteine (CHEBI:90364) has role Escherichia coli metabolite (CHEBI:76971) |
| S-(5-deoxy-β-D-ribos-5-yl)-L-homocysteine (CHEBI:90364) is a S-(5-deoxy-D-ribos-5-yl)-L-homocysteine (CHEBI:17575) |
| IUPAC Name |
|---|
| (2S)-2-Amino-4-({[(2S,3S,4R,5R)-3,4,5-trihydroxytetrahydro-2-furanyl]methyl}sulfanyl)butanoic acid |
| Synonyms | Source |
|---|---|
| S-ribosyl-L-homocysteine | ChEBI |
| Ribose-5-S-homocysteine | MetaCyc |
| S-(5-Deoxy-D-ribos-5-yl)-L-homocysteine | MetaCyc |
| S-D-Ribosyl-L-homocysteine | MetaCyc |
| S-Ribosylhomocysteine | MetaCyc |
| Citations |
|---|