EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO2S |
| Net Charge | 0 |
| Average Mass | 135.188 |
| Monoisotopic Mass | 135.03540 |
| SMILES | [NH3+][C@@H](CCS)C(=O)[O-] |
| InChI | InChI=1S/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7)/t3-/m0/s1 |
| InChIKey | FFFHZYDWPBMWHY-VKHMYHEASA-N |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-homocysteine zwitterion (CHEBI:58199) has role fundamental metabolite (CHEBI:78675) |
| L-homocysteine zwitterion (CHEBI:58199) is a amino-acid zwitterion (CHEBI:35238) |
| L-homocysteine zwitterion (CHEBI:58199) is tautomer of L-homocysteine (CHEBI:17588) |
| Incoming Relation(s) |
| L-homolanthionine dizwitterion (CHEBI:178194) has functional parent L-homocysteine zwitterion (CHEBI:58199) |
| L-homocysteine (CHEBI:17588) is tautomer of L-homocysteine zwitterion (CHEBI:58199) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-4-sulfanylbutanoate |
| UniProt Name | Source |
|---|---|
| L-homocysteine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HOMO-CYS | MetaCyc |