EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8NO2S |
| Net Charge | -1 |
| Average Mass | 134.180 |
| Monoisotopic Mass | 134.02812 |
| SMILES | N[C@@H](CCS)C(=O)[O-] |
| InChI | InChI=1S/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7)/p-1/t3-/m0/s1 |
| InChIKey | FFFHZYDWPBMWHY-VKHMYHEASA-M |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-homocysteinate (CHEBI:63072) is a L-α-amino acid anion (CHEBI:59814) |
| L-homocysteinate (CHEBI:63072) is a homocysteinate (CHEBI:66952) |
| L-homocysteinate (CHEBI:63072) is conjugate base of L-homocysteine (CHEBI:17588) |
| Incoming Relation(s) |
| L-homocysteine (CHEBI:17588) is conjugate acid of L-homocysteinate (CHEBI:63072) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-sulfanylbutanoate |
| Synonyms | Source |
|---|---|
| L-homocysteinate anion | ChEBI |
| L-homocysteinate(1−) | ChEBI |
| L-homocysteate | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| L-HOMOCYSTEATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6965804 | Reaxys |